C26H25N3O6 — CID 19156368
ethyl 2-[[(4E)-4-[(4-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]amino]benzoate (PubChem CID 19156368) has the molecular formula C26H25N3O6 and a molecular weight of 475.50 g/mol. Its IUPAC name is ethyl 2-[[(4E)-4-[(4-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[(4E)-4-[(4-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 19156368 |
| Molecular Formula | C26H25N3O6 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | ethyl 2-[[(4E)-4-[(4-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1oc2c(c1C)/C(=N/NC(=O)c1ccc(O)cc1)CCC2 |
| InChI | InChI=1S/C26H25N3O6/c1-3-34-26(33)18-7-4-5-8-19(18)27-25(32)23-15(2)22-20(9-6-10-21(22)35-23)28-29-24(31)16-11-13-17(30)14-12-16/h4-5,7-8,11-14,30H,3,6,9-10H2,1-2H3,(H,27,32)(H,29,31)/b28-20+ |
| InChIKey | UATSZOMBNVPHNF-VFCFBJKWSA-N |
| XLogP | 4.19 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|