C24H21ClN4O5 — CID 19163224
N-[(E)-[2-[[(2-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-hydroxybenzamide (PubChem CID 19163224) has the molecular formula C24H21ClN4O5 and a molecular weight of 480.91 g/mol. Its IUPAC name is N-[(E)-[2-[[(2-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-hydroxybenzamide.
| Compound Name | N-[(E)-[2-[[(2-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 19163224 |
| Molecular Formula | C24H21ClN4O5 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-[(E)-[2-[[(2-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-hydroxybenzamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2Cl)oc2c1/C(=N/NC(=O)c1ccccc1O)CCC2 |
| InChI | InChI=1S/C24H21ClN4O5/c1-13-20-17(26-27-23(32)15-8-3-5-11-18(15)30)10-6-12-19(20)34-21(13)24(33)29-28-22(31)14-7-2-4-9-16(14)25/h2-5,7-9,11,30H,6,10,12H2,1H3,(H,27,32)(H,28,31)(H,29,33)/b26-17+ |
| InChIKey | OBQRZXUYNNYKFE-YZSQISJMSA-N |
| XLogP | 3.49 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|