C24H21Cl2N5O3S — CID 19162556
1-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-phenylthiourea (PubChem CID 19162556) has the molecular formula C24H21Cl2N5O3S and a molecular weight of 530.44 g/mol. Its IUPAC name is 1-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 19162556 |
| Molecular Formula | C24H21Cl2N5O3S |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | 1-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-phenylthiourea |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Cl)cc2Cl)oc2c1/C(=N/NC(=S)Nc1ccccc1)CCC2 |
| InChI | InChI=1S/C24H21Cl2N5O3S/c1-13-20-18(28-31-24(35)27-15-6-3-2-4-7-15)8-5-9-19(20)34-21(13)23(33)30-29-22(32)16-11-10-14(25)12-17(16)26/h2-4,6-7,10-12H,5,8-9H2,1H3,(H,29,32)(H,30,33)(H2,27,31,35)/b28-18+ |
| InChIKey | UUWZQZSUOYRLTR-MTDXEUNCSA-N |
| XLogP | 5.00 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|