C30H26BrN3O3 — CID 19160733
(4E)-N-(2-bromo-4-methylphenyl)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160733) has the molecular formula C30H26BrN3O3 and a molecular weight of 556.46 g/mol. Its IUPAC name is (4E)-N-(2-bromo-4-methylphenyl)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2-bromo-4-methylphenyl)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160733 |
| Molecular Formula | C30H26BrN3O3 |
| Molecular Weight | 556.46 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | (4E)-N-(2-bromo-4-methylphenyl)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2oc3c(c2C)/C(=N/NC(=O)c2ccc(-c4ccccc4)cc2)CCC3)c(Br)c1 |
| InChI | InChI=1S/C30H26BrN3O3/c1-18-11-16-24(23(31)17-18)32-30(36)28-19(2)27-25(9-6-10-26(27)37-28)33-34-29(35)22-14-12-21(13-15-22)20-7-4-3-5-8-20/h3-5,7-8,11-17H,6,9-10H2,1-2H3,(H,32,36)(H,34,35)/b33-25+ |
| InChIKey | GGCHEDMMPXARQJ-INKHBPHZSA-N |
| XLogP | 7.05 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.46 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|