C23H22F3N3O2S — CID 19161763
(4E)-3-methyl-N-(2-thiophen-2-ylethyl)-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19161763) has the molecular formula C23H22F3N3O2S and a molecular weight of 461.51 g/mol. Its IUPAC name is (4E)-3-methyl-N-(2-thiophen-2-ylethyl)-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-3-methyl-N-(2-thiophen-2-ylethyl)-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19161763 |
| Molecular Formula | C23H22F3N3O2S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (4E)-3-methyl-N-(2-thiophen-2-ylethyl)-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2cccs2)oc2c1/C(=N/Nc1cccc(C(F)(F)F)c1)CCC2 |
| InChI | InChI=1S/C23H22F3N3O2S/c1-14-20-18(29-28-16-6-2-5-15(13-16)23(24,25)26)8-3-9-19(20)31-21(14)22(30)27-11-10-17-7-4-12-32-17/h2,4-7,12-13,28H,3,8-11H2,1H3,(H,27,30)/b29-18+ |
| InChIKey | QCMUPZUZMQKLJZ-RDRPBHBLSA-N |
| XLogP | 5.79 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|