C20H18F7N3O3S — CID 19161091
(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-(2-thiophen-2-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19161091) has the molecular formula C20H18F7N3O3S and a molecular weight of 513.44 g/mol. Its IUPAC name is (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-(2-thiophen-2-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-(2-thiophen-2-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19161091 |
| Molecular Formula | C20H18F7N3O3S |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-(2-thiophen-2-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2cccs2)oc2c1/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C20H18F7N3O3S/c1-10-14-12(29-30-17(32)18(21,22)19(23,24)20(25,26)27)5-2-6-13(14)33-15(10)16(31)28-8-7-11-4-3-9-34-11/h3-4,9H,2,5-8H2,1H3,(H,28,31)(H,30,32)/b29-12+ |
| InChIKey | CLGFZVZBJIDCHS-XKJRVUDJSA-N |
| XLogP | 4.61 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|