C21H18F7N3O3 — CID 19161001
(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-N,3-dimethyl-N-phenyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19161001) has the molecular formula C21H18F7N3O3 and a molecular weight of 493.38 g/mol. Its IUPAC name is (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-N,3-dimethyl-N-phenyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-N,3-dimethyl-N-phenyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19161001 |
| Molecular Formula | C21H18F7N3O3 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-N,3-dimethyl-N-phenyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)c2ccccc2)oc2c1/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C21H18F7N3O3/c1-11-15-13(29-30-18(33)19(22,23)20(24,25)21(26,27)28)9-6-10-14(15)34-16(11)17(32)31(2)12-7-4-3-5-8-12/h3-5,7-8H,6,9-10H2,1-2H3,(H,30,33)/b29-13+ |
| InChIKey | YXIXZDIBXHKPQG-VFLNYLIXSA-N |
| XLogP | 4.85 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|