C24H18F7N3O3 — CID 19161002
(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-naphthalen-1-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19161002) has the molecular formula C24H18F7N3O3 and a molecular weight of 529.41 g/mol. Its IUPAC name is (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-naphthalen-1-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-naphthalen-1-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19161002 |
| Molecular Formula | C24H18F7N3O3 |
| Molecular Weight | 529.41 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-N-naphthalen-1-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc3ccccc23)oc2c1/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C24H18F7N3O3/c1-12-18-16(33-34-21(36)22(25,26)23(27,28)24(29,30)31)10-5-11-17(18)37-19(12)20(35)32-15-9-4-7-13-6-2-3-8-14(13)15/h2-4,6-9H,5,10-11H2,1H3,(H,32,35)(H,34,36)/b33-16+ |
| InChIKey | XTXGJNMNEOKPIO-MHDJOFBISA-N |
| XLogP | 5.98 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|