C26H21F7N4O3 — CID 19161009
2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-[(N-phenylanilino)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide (PubChem CID 19161009) has the molecular formula C26H21F7N4O3 and a molecular weight of 570.47 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-[(N-phenylanilino)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-[(N-phenylanilino)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide |
|---|---|
| PubChem CID | 19161009 |
| Molecular Formula | C26H21F7N4O3 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[(E)-[3-methyl-2-[(N-phenylanilino)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]butanamide |
| SMILES | Cc1c(C(=O)NN(c2ccccc2)c2ccccc2)oc2c1/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C26H21F7N4O3/c1-15-20-18(34-35-23(39)24(27,28)25(29,30)26(31,32)33)13-8-14-19(20)40-21(15)22(38)36-37(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12H,8,13-14H2,1H3,(H,35,39)(H,36,38)/b34-18+ |
| InChIKey | MSLASNRKRLEAMP-FABQOPTDSA-N |
| XLogP | 6.06 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|