C28H25FN4O2 — CID 19161513
(4E)-4-[(4-fluorophenyl)hydrazinylidene]-3-methyl-N',N'-diphenyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide (PubChem CID 19161513) has the molecular formula C28H25FN4O2 and a molecular weight of 468.53 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)hydrazinylidene]-3-methyl-N',N'-diphenyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide.
| Compound Name | (4E)-4-[(4-fluorophenyl)hydrazinylidene]-3-methyl-N',N'-diphenyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 19161513 |
| Molecular Formula | C28H25FN4O2 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)hydrazinylidene]-3-methyl-N',N'-diphenyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NN(c2ccccc2)c2ccccc2)oc2c1/C(=N/Nc1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C28H25FN4O2/c1-19-26-24(31-30-21-17-15-20(29)16-18-21)13-8-14-25(26)35-27(19)28(34)32-33(22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-7,9-12,15-18,30H,8,13-14H2,1H3,(H,32,34)/b31-24+ |
| InChIKey | OLKBKIQAOIZNOJ-QFMPWRQOSA-N |
| XLogP | 6.36 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|