C23H21FN4O3 — CID 19161539
(4E)-N'-benzoyl-4-[(4-fluorophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide (PubChem CID 19161539) has the molecular formula C23H21FN4O3 and a molecular weight of 420.44 g/mol. Its IUPAC name is (4E)-N'-benzoyl-4-[(4-fluorophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide.
| Compound Name | (4E)-N'-benzoyl-4-[(4-fluorophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 19161539 |
| Molecular Formula | C23H21FN4O3 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (4E)-N'-benzoyl-4-[(4-fluorophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2)oc2c1/C(=N/Nc1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C23H21FN4O3/c1-14-20-18(26-25-17-12-10-16(24)11-13-17)8-5-9-19(20)31-21(14)23(30)28-27-22(29)15-6-3-2-4-7-15/h2-4,6-7,10-13,25H,5,8-9H2,1H3,(H,27,29)(H,28,30)/b26-18+ |
| InChIKey | QAQALRGASSYGQG-NLRVBDNBSA-N |
| XLogP | 3.95 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|