C23H21N5O5 — CID 19161881
(4E)-3-methyl-N'-(4-nitrobenzoyl)-4-(phenylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide (PubChem CID 19161881) has the molecular formula C23H21N5O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is (4E)-3-methyl-N'-(4-nitrobenzoyl)-4-(phenylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide.
| Compound Name | (4E)-3-methyl-N'-(4-nitrobenzoyl)-4-(phenylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 19161881 |
| Molecular Formula | C23H21N5O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (4E)-3-methyl-N'-(4-nitrobenzoyl)-4-(phenylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)oc2c1/C(=N/Nc1ccccc1)CCC2 |
| InChI | InChI=1S/C23H21N5O5/c1-14-20-18(25-24-16-6-3-2-4-7-16)8-5-9-19(20)33-21(14)23(30)27-26-22(29)15-10-12-17(13-11-15)28(31)32/h2-4,6-7,10-13,24H,5,8-9H2,1H3,(H,26,29)(H,27,30)/b25-18+ |
| InChIKey | IRVKAAJGIGNKRQ-XIEYBQDHSA-N |
| XLogP | 3.72 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|