C16H14KN3O5 — CID 19159209
potassium (4E)-3-methyl-4-[(4-nitrophenyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19159209) has the molecular formula C16H14KN3O5 and a molecular weight of 367.40 g/mol. Its IUPAC name is potassium (4E)-3-methyl-4-[(4-nitrophenyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | potassium (4E)-3-methyl-4-[(4-nitrophenyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19159209 |
| Molecular Formula | C16H14KN3O5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | potassium (4E)-3-methyl-4-[(4-nitrophenyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)[O-])oc2c1/C(=N/Nc1ccc([N+](=O)[O-])cc1)CCC2.[K+] |
| InChI | InChI=1S/C16H15N3O5.K/c1-9-14-12(3-2-4-13(14)24-15(9)16(20)21)18-17-10-5-7-11(8-6-10)19(22)23;/h5-8,17H,2-4H2,1H3,(H,20,21);/q;+1/p-1/b18-12+; |
| InChIKey | HNMQVNYLRQJQQZ-XMMWENQYSA-M |
| XLogP | -0.98 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|