C19H21N3O5 — CID 19159240
propan-2-yl (4E)-3-methyl-4-[(4-nitrophenyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19159240) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is propan-2-yl (4E)-3-methyl-4-[(4-nitrophenyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | propan-2-yl (4E)-3-methyl-4-[(4-nitrophenyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19159240 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | propan-2-yl (4E)-3-methyl-4-[(4-nitrophenyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)oc2c1/C(=N/Nc1ccc([N+](=O)[O-])cc1)CCC2 |
| InChI | InChI=1S/C19H21N3O5/c1-11(2)26-19(23)18-12(3)17-15(5-4-6-16(17)27-18)21-20-13-7-9-14(10-8-13)22(24)25/h7-11,20H,4-6H2,1-3H3/b21-15+ |
| InChIKey | ONSCJFSBWNCQOZ-RCCKNPSSSA-N |
| XLogP | 4.21 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|