C21H22F7N3O5 — CID 19160927
methyl 1-[(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]piperidine-4-carboxylate (PubChem CID 19160927) has the molecular formula C21H22F7N3O5 and a molecular weight of 529.41 g/mol. Its IUPAC name is methyl 1-[(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19160927 |
| Molecular Formula | C21H22F7N3O5 |
| Molecular Weight | 529.41 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | methyl 1-[(4E)-4-(2,2,3,3,4,4,4-heptafluorobutanoylhydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2oc3c(c2C)/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC3)CC1 |
| InChI | InChI=1S/C21H22F7N3O5/c1-10-14-12(29-30-18(34)19(22,23)20(24,25)21(26,27)28)4-3-5-13(14)36-15(10)16(32)31-8-6-11(7-9-31)17(33)35-2/h11H,3-9H2,1-2H3,(H,30,34)/b29-12+ |
| InChIKey | SDIMRWYGAGXQNQ-XKJRVUDJSA-N |
| XLogP | 3.60 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|