C23H20F7N3O3 — CID 19161014
N-[(E)-[2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 19161014) has the molecular formula C23H20F7N3O3 and a molecular weight of 519.42 g/mol. Its IUPAC name is N-[(E)-[2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[(E)-[2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 19161014 |
| Molecular Formula | C23H20F7N3O3 |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | N-[(E)-[2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | Cc1c(C(=O)N2CCc3ccccc3C2)oc2c1/C(=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C23H20F7N3O3/c1-12-17-15(31-32-20(35)21(24,25)22(26,27)23(28,29)30)7-4-8-16(17)36-18(12)19(34)33-10-9-13-5-2-3-6-14(13)11-33/h2-3,5-6H,4,7-11H2,1H3,(H,32,35)/b31-15+ |
| InChIKey | CXXXWOAZVKHNFS-IBBHUPRXSA-N |
| XLogP | 4.78 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|