C26H24FN3O3 — CID 19156647
N-[(E)-[2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-fluorobenzamide (PubChem CID 19156647) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[(E)-[2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-fluorobenzamide.
| Compound Name | N-[(E)-[2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 19156647 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[(E)-[2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-fluorobenzamide |
| SMILES | Cc1c(C(=O)N2CCCc3ccccc32)oc2c1/C(=N/NC(=O)c1ccccc1F)CCC2 |
| InChI | InChI=1S/C26H24FN3O3/c1-16-23-20(28-29-25(31)18-10-3-4-11-19(18)27)12-6-14-22(23)33-24(16)26(32)30-15-7-9-17-8-2-5-13-21(17)30/h2-5,8,10-11,13H,6-7,9,12,14-15H2,1H3,(H,29,31)/b28-20+ |
| InChIKey | STFSZWZCKPKXMC-VFCFBJKWSA-N |
| XLogP | 4.79 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|