C26H26FN3O3 — CID 19156691
(4E)-N-ethyl-4-[(2-fluorobenzoyl)hydrazinylidene]-3-methyl-N-(3-methylphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19156691) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is (4E)-N-ethyl-4-[(2-fluorobenzoyl)hydrazinylidene]-3-methyl-N-(3-methylphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-ethyl-4-[(2-fluorobenzoyl)hydrazinylidene]-3-methyl-N-(3-methylphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19156691 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (4E)-N-ethyl-4-[(2-fluorobenzoyl)hydrazinylidene]-3-methyl-N-(3-methylphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | CCN(C(=O)c1oc2c(c1C)/C(=N/NC(=O)c1ccccc1F)CCC2)c1cccc(C)c1 |
| InChI | InChI=1S/C26H26FN3O3/c1-4-30(18-10-7-9-16(2)15-18)26(32)24-17(3)23-21(13-8-14-22(23)33-24)28-29-25(31)19-11-5-6-12-20(19)27/h5-7,9-12,15H,4,8,13-14H2,1-3H3,(H,29,31)/b28-21+ |
| InChIKey | QSIVLWFNCHPCFN-SGWCAAJKSA-N |
| XLogP | 5.17 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|