C25H23BrN4O3 — CID 19160845
5-bromo-N-[(E)-[2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide (PubChem CID 19160845) has the molecular formula C25H23BrN4O3 and a molecular weight of 507.39 g/mol. Its IUPAC name is 5-bromo-N-[(E)-[2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(E)-[2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 19160845 |
| Molecular Formula | C25H23BrN4O3 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 5-bromo-N-[(E)-[2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide |
| SMILES | Cc1c(C(=O)N2CCCc3ccccc32)oc2c1/C(=N/NC(=O)c1cncc(Br)c1)CCC2 |
| InChI | InChI=1S/C25H23BrN4O3/c1-15-22-19(28-29-24(31)17-12-18(26)14-27-13-17)8-4-10-21(22)33-23(15)25(32)30-11-5-7-16-6-2-3-9-20(16)30/h2-3,6,9,12-14H,4-5,7-8,10-11H2,1H3,(H,29,31)/b28-19+ |
| InChIKey | KSWHSFFNVNJYIN-TURZUDJPSA-N |
| XLogP | 4.81 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|