C23H20BrN5O4 — CID 19158526
N-[(E)-[2-[[(2-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide (PubChem CID 19158526) has the molecular formula C23H20BrN5O4 and a molecular weight of 510.35 g/mol. Its IUPAC name is N-[(E)-[2-[[(2-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-[2-[[(2-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 19158526 |
| Molecular Formula | C23H20BrN5O4 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | N-[(E)-[2-[[(2-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-3-carboxamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2Br)oc2c1/C(=N/NC(=O)c1cccnc1)CCC2 |
| InChI | InChI=1S/C23H20BrN5O4/c1-13-19-17(26-27-21(30)14-6-5-11-25-12-14)9-4-10-18(19)33-20(13)23(32)29-28-22(31)15-7-2-3-8-16(15)24/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,27,30)(H,28,31)(H,29,32)/b26-17+ |
| InChIKey | WOJVZEYGKFAHHK-YZSQISJMSA-N |
| XLogP | 3.29 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|