C26H24BrN3O3 — CID 19155934
4-bromo-N-[(E)-[3-methyl-2-(2-methyl-2,3-dihydroindole-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]benzamide (PubChem CID 19155934) has the molecular formula C26H24BrN3O3 and a molecular weight of 506.40 g/mol. Its IUPAC name is 4-bromo-N-[(E)-[3-methyl-2-(2-methyl-2,3-dihydroindole-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]benzamide.
| Compound Name | 4-bromo-N-[(E)-[3-methyl-2-(2-methyl-2,3-dihydroindole-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 19155934 |
| Molecular Formula | C26H24BrN3O3 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 4-bromo-N-[(E)-[3-methyl-2-(2-methyl-2,3-dihydroindole-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]benzamide |
| SMILES | Cc1c(C(=O)N2c3ccccc3CC2C)oc2c1/C(=N/NC(=O)c1ccc(Br)cc1)CCC2 |
| InChI | InChI=1S/C26H24BrN3O3/c1-15-14-18-6-3-4-8-21(18)30(15)26(32)24-16(2)23-20(7-5-9-22(23)33-24)28-29-25(31)17-10-12-19(27)13-11-17/h3-4,6,8,10-13,15H,5,7,9,14H2,1-2H3,(H,29,31)/b28-20+ |
| InChIKey | WLNGKZHIBBMMAL-VFCFBJKWSA-N |
| XLogP | 5.41 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|