C30H27N3O3 — CID 19157782
N-[(E)-[3-methyl-2-(2-methyl-2,3-dihydroindole-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]naphthalene-1-carboxamide (PubChem CID 19157782) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-[(E)-[3-methyl-2-(2-methyl-2,3-dihydroindole-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]naphthalene-1-carboxamide.
| Compound Name | N-[(E)-[3-methyl-2-(2-methyl-2,3-dihydroindole-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 19157782 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[(E)-[3-methyl-2-(2-methyl-2,3-dihydroindole-1-carbonyl)-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]naphthalene-1-carboxamide |
| SMILES | Cc1c(C(=O)N2c3ccccc3CC2C)oc2c1/C(=N/NC(=O)c1cccc3ccccc13)CCC2 |
| InChI | InChI=1S/C30H27N3O3/c1-18-17-21-10-4-6-15-25(21)33(18)30(35)28-19(2)27-24(14-8-16-26(27)36-28)31-32-29(34)23-13-7-11-20-9-3-5-12-22(20)23/h3-7,9-13,15,18H,8,14,16-17H2,1-2H3,(H,32,34)/b31-24+ |
| InChIKey | UJLQIDQTYOUJAP-QFMPWRQOSA-N |
| XLogP | 5.80 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|