C27H21Cl2N3O3 — CID 19157821
(4E)-N-(2,3-dichlorophenyl)-3-methyl-4-(naphthalene-1-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19157821) has the molecular formula C27H21Cl2N3O3 and a molecular weight of 506.39 g/mol. Its IUPAC name is (4E)-N-(2,3-dichlorophenyl)-3-methyl-4-(naphthalene-1-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2,3-dichlorophenyl)-3-methyl-4-(naphthalene-1-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19157821 |
| Molecular Formula | C27H21Cl2N3O3 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | (4E)-N-(2,3-dichlorophenyl)-3-methyl-4-(naphthalene-1-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(Cl)c2Cl)oc2c1/C(=N/NC(=O)c1cccc3ccccc13)CCC2 |
| InChI | InChI=1S/C27H21Cl2N3O3/c1-15-23-20(31-32-26(33)18-10-4-8-16-7-2-3-9-17(16)18)12-6-14-22(23)35-25(15)27(34)30-21-13-5-11-19(28)24(21)29/h2-5,7-11,13H,6,12,14H2,1H3,(H,30,34)(H,32,33)/b31-20+ |
| InChIKey | VCPPYFSWCFIGSS-AJBULDERSA-N |
| XLogP | 6.77 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|