C22H19Cl2N3O4S — CID 19159499
(4E)-4-(benzenesulfonylhydrazinylidene)-N-(2,3-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19159499) has the molecular formula C22H19Cl2N3O4S and a molecular weight of 492.38 g/mol. Its IUPAC name is (4E)-4-(benzenesulfonylhydrazinylidene)-N-(2,3-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-(benzenesulfonylhydrazinylidene)-N-(2,3-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19159499 |
| Molecular Formula | C22H19Cl2N3O4S |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | (4E)-4-(benzenesulfonylhydrazinylidene)-N-(2,3-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(Cl)c2Cl)oc2c1/C(=N/NS(=O)(=O)c1ccccc1)CCC2 |
| InChI | InChI=1S/C22H19Cl2N3O4S/c1-13-19-16(26-27-32(29,30)14-7-3-2-4-8-14)10-6-12-18(19)31-21(13)22(28)25-17-11-5-9-15(23)20(17)24/h2-5,7-9,11,27H,6,10,12H2,1H3,(H,25,28)/b26-16+ |
| InChIKey | KFILBTHDKYJGHK-WGOQTCKBSA-N |
| XLogP | 5.17 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|