C17H16Cl2N4O3 — CID 19162017
(4E)-4-(carbamoylhydrazinylidene)-N-(2,3-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19162017) has the molecular formula C17H16Cl2N4O3 and a molecular weight of 395.25 g/mol. Its IUPAC name is (4E)-4-(carbamoylhydrazinylidene)-N-(2,3-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-(carbamoylhydrazinylidene)-N-(2,3-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19162017 |
| Molecular Formula | C17H16Cl2N4O3 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (4E)-4-(carbamoylhydrazinylidene)-N-(2,3-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(Cl)c2Cl)oc2c1/C(=N/NC(N)=O)CCC2 |
| InChI | InChI=1S/C17H16Cl2N4O3/c1-8-13-10(22-23-17(20)25)5-3-7-12(13)26-15(8)16(24)21-11-6-2-4-9(18)14(11)19/h2,4,6H,3,5,7H2,1H3,(H,21,24)(H3,20,23,25)/b22-10+ |
| InChIKey | SXNSNFSVGFEGAA-LSHDLFTRSA-N |
| XLogP | 3.86 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|