C30H26ClN3O3 — CID 19159842
(4E)-N-(2-chlorophenyl)-4-[(2,2-diphenylacetyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19159842) has the molecular formula C30H26ClN3O3 and a molecular weight of 512.01 g/mol. Its IUPAC name is (4E)-N-(2-chlorophenyl)-4-[(2,2-diphenylacetyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2-chlorophenyl)-4-[(2,2-diphenylacetyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19159842 |
| Molecular Formula | C30H26ClN3O3 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (4E)-N-(2-chlorophenyl)-4-[(2,2-diphenylacetyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2Cl)oc2c1/C(=N/NC(=O)C(c1ccccc1)c1ccccc1)CCC2 |
| InChI | InChI=1S/C30H26ClN3O3/c1-19-26-24(17-10-18-25(26)37-28(19)30(36)32-23-16-9-8-15-22(23)31)33-34-29(35)27(20-11-4-2-5-12-20)21-13-6-3-7-14-21/h2-9,11-16,27H,10,17-18H2,1H3,(H,32,36)(H,34,35)/b33-24+ |
| InChIKey | XHVYLZPXYQXFBS-IWBSIUBASA-N |
| XLogP | 6.48 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|