C27H29N3O3 — CID 19159807
(4E)-4-[(2,2-diphenylacetyl)hydrazinylidene]-3-methyl-N-propan-2-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19159807) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is (4E)-4-[(2,2-diphenylacetyl)hydrazinylidene]-3-methyl-N-propan-2-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(2,2-diphenylacetyl)hydrazinylidene]-3-methyl-N-propan-2-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19159807 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (4E)-4-[(2,2-diphenylacetyl)hydrazinylidene]-3-methyl-N-propan-2-yl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)C)oc2c1/C(=N/NC(=O)C(c1ccccc1)c1ccccc1)CCC2 |
| InChI | InChI=1S/C27H29N3O3/c1-17(2)28-27(32)25-18(3)23-21(15-10-16-22(23)33-25)29-30-26(31)24(19-11-6-4-7-12-19)20-13-8-5-9-14-20/h4-9,11-14,17,24H,10,15-16H2,1-3H3,(H,28,32)(H,30,31)/b29-21+ |
| InChIKey | BUHDYTNTOAZMOX-XHLNEMQHSA-N |
| XLogP | 4.71 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|