C29H27N3O3S — CID 19160755
(4E)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-N-(2-thiophen-2-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160755) has the molecular formula C29H27N3O3S and a molecular weight of 497.62 g/mol. Its IUPAC name is (4E)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-N-(2-thiophen-2-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-N-(2-thiophen-2-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160755 |
| Molecular Formula | C29H27N3O3S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (4E)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-N-(2-thiophen-2-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2cccs2)oc2c1/C(=N/NC(=O)c1ccc(-c3ccccc3)cc1)CCC2 |
| InChI | InChI=1S/C29H27N3O3S/c1-19-26-24(31-32-28(33)22-14-12-21(13-15-22)20-7-3-2-4-8-20)10-5-11-25(26)35-27(19)29(34)30-17-16-23-9-6-18-36-23/h2-4,6-9,12-15,18H,5,10-11,16-17H2,1H3,(H,30,34)(H,32,33)/b31-24+ |
| InChIKey | OAQNPPFGXZUVKW-QFMPWRQOSA-N |
| XLogP | 5.76 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|