C31H29N3O3 — CID 19160722
(4E)-N-benzyl-N,3-dimethyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160722) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is (4E)-N-benzyl-N,3-dimethyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-benzyl-N,3-dimethyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160722 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (4E)-N-benzyl-N,3-dimethyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)Cc2ccccc2)oc2c1/C(=N/NC(=O)c1ccc(-c3ccccc3)cc1)CCC2 |
| InChI | InChI=1S/C31H29N3O3/c1-21-28-26(32-33-30(35)25-18-16-24(17-19-25)23-12-7-4-8-13-23)14-9-15-27(28)37-29(21)31(36)34(2)20-22-10-5-3-6-11-22/h3-8,10-13,16-19H,9,14-15,20H2,1-2H3,(H,33,35)/b32-26+ |
| InChIKey | DCQIGZKFEJKKGS-HMZBKAONSA-N |
| XLogP | 6.00 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|