C23H18F3N5O6 — CID 19159294
(4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-N-[2-(trifluoromethyl)phenyl]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19159294) has the molecular formula C23H18F3N5O6 and a molecular weight of 517.42 g/mol. Its IUPAC name is (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-N-[2-(trifluoromethyl)phenyl]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-N-[2-(trifluoromethyl)phenyl]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19159294 |
| Molecular Formula | C23H18F3N5O6 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-N-[2-(trifluoromethyl)phenyl]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2C(F)(F)F)oc2c1/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CCC2 |
| InChI | InChI=1S/C23H18F3N5O6/c1-12-20-17(29-28-16-10-9-13(30(33)34)11-18(16)31(35)36)7-4-8-19(20)37-21(12)22(32)27-15-6-3-2-5-14(15)23(24,25)26/h2-3,5-6,9-11,28H,4,7-8H2,1H3,(H,27,32)/b29-17+ |
| InChIKey | NZFCZCGXSSWYKA-STBIYBPSSA-N |
| XLogP | 5.83 |
| TPSA | 152.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|