C24H21FN4O5 — CID 19158929
(4E)-N-(2-fluorophenyl)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19158929) has the molecular formula C24H21FN4O5 and a molecular weight of 464.45 g/mol. Its IUPAC name is (4E)-N-(2-fluorophenyl)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2-fluorophenyl)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19158929 |
| Molecular Formula | C24H21FN4O5 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (4E)-N-(2-fluorophenyl)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2F)oc2c1/C(=N/NC(=O)Cc1ccc([N+](=O)[O-])cc1)CCC2 |
| InChI | InChI=1S/C24H21FN4O5/c1-14-22-19(27-28-21(30)13-15-9-11-16(12-10-15)29(32)33)7-4-8-20(22)34-23(14)24(31)26-18-6-3-2-5-17(18)25/h2-3,5-6,9-12H,4,7-8,13H2,1H3,(H,26,31)(H,28,30)/b27-19+ |
| InChIKey | LZZXEVLVVGTEIU-ZXVVBBHZSA-N |
| XLogP | 4.29 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|