C30H26N6O5 — CID 19158994
(4E)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-N-(4-phenyldiazenylphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19158994) has the molecular formula C30H26N6O5 and a molecular weight of 550.58 g/mol. Its IUPAC name is (4E)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-N-(4-phenyldiazenylphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-N-(4-phenyldiazenylphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19158994 |
| Molecular Formula | C30H26N6O5 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | (4E)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-N-(4-phenyldiazenylphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(/N=N/c3ccccc3)cc2)oc2c1/C(=N/NC(=O)Cc1ccc([N+](=O)[O-])cc1)CCC2 |
| InChI | InChI=1S/C30H26N6O5/c1-19-28-25(34-35-27(37)18-20-10-16-24(17-11-20)36(39)40)8-5-9-26(28)41-29(19)30(38)31-21-12-14-23(15-13-21)33-32-22-6-3-2-4-7-22/h2-4,6-7,10-17H,5,8-9,18H2,1H3,(H,31,38)(H,35,37)/b33-32+,34-25+ |
| InChIKey | FKOIOPKKGBQRLE-PARHTJLUSA-N |
| XLogP | 6.56 |
| TPSA | 151.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|