C30H25ClN4O6 — CID 19159047
(4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19159047) has the molecular formula C30H25ClN4O6 and a molecular weight of 573.01 g/mol. Its IUPAC name is (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19159047 |
| Molecular Formula | C30H25ClN4O6 |
| Molecular Weight | 573.01 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(Cl)ccc2Oc2ccccc2)oc2c1/C(=N/NC(=O)Cc1ccc([N+](=O)[O-])cc1)CCC2 |
| InChI | InChI=1S/C30H25ClN4O6/c1-18-28-23(33-34-27(36)16-19-10-13-21(14-11-19)35(38)39)8-5-9-26(28)41-29(18)30(37)32-24-17-20(31)12-15-25(24)40-22-6-3-2-4-7-22/h2-4,6-7,10-15,17H,5,8-9,16H2,1H3,(H,32,37)(H,34,36)/b33-23+ |
| InChIKey | LCNCZRVAXISQAZ-GZZLJNBRSA-N |
| XLogP | 6.59 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.01 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|