C30H26ClN3O4 — CID 19160053
(4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[(2-phenylacetyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160053) has the molecular formula C30H26ClN3O4 and a molecular weight of 528.01 g/mol. Its IUPAC name is (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[(2-phenylacetyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[(2-phenylacetyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160053 |
| Molecular Formula | C30H26ClN3O4 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[(2-phenylacetyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(Cl)ccc2Oc2ccccc2)oc2c1/C(=N/NC(=O)Cc1ccccc1)CCC2 |
| InChI | InChI=1S/C30H26ClN3O4/c1-19-28-23(33-34-27(35)17-20-9-4-2-5-10-20)13-8-14-26(28)38-29(19)30(36)32-24-18-21(31)15-16-25(24)37-22-11-6-3-7-12-22/h2-7,9-12,15-16,18H,8,13-14,17H2,1H3,(H,32,36)(H,34,35)/b33-23+ |
| InChIKey | BJXIFFBNUHSVAG-GZZLJNBRSA-N |
| XLogP | 6.69 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|