C23H21N5O7 — CID 19159350
(4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-N-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19159350) has the molecular formula C23H21N5O7 and a molecular weight of 479.45 g/mol. Its IUPAC name is (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-N-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-N-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19159350 |
| Molecular Formula | C23H21N5O7 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-N-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2oc3c(c2C)/C(=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCC3)cc1 |
| InChI | InChI=1S/C23H21N5O7/c1-13-21-18(26-25-17-11-8-15(27(30)31)12-19(17)28(32)33)4-3-5-20(21)35-22(13)23(29)24-14-6-9-16(34-2)10-7-14/h6-12,25H,3-5H2,1-2H3,(H,24,29)/b26-18+ |
| InChIKey | DEHWYGDTFSAIRR-NLRVBDNBSA-N |
| XLogP | 4.82 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|