C18H19BrN6O3 — CID 19162379
2-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]guanidine (PubChem CID 19162379) has the molecular formula C18H19BrN6O3 and a molecular weight of 447.29 g/mol. Its IUPAC name is 2-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]guanidine.
| Compound Name | 2-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 19162379 |
| Molecular Formula | C18H19BrN6O3 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]guanidine |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Br)cc2)oc2c1/C(=N/N=C(N)N)CCC2 |
| InChI | InChI=1S/C18H19BrN6O3/c1-9-14-12(22-25-18(20)21)3-2-4-13(14)28-15(9)17(27)24-23-16(26)10-5-7-11(19)8-6-10/h5-8H,2-4H2,1H3,(H,23,26)(H,24,27)(H4,20,21,25)/b22-12+ |
| InChIKey | IKBQCNGVPDYWTG-WSDLNYQXSA-N |
| XLogP | 1.74 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|