C23H21BrN4O5 — CID 19161206
N-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-methylfuran-3-carboxamide (PubChem CID 19161206) has the molecular formula C23H21BrN4O5 and a molecular weight of 513.35 g/mol. Its IUPAC name is N-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-methylfuran-3-carboxamide.
| Compound Name | N-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 19161206 |
| Molecular Formula | C23H21BrN4O5 |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | N-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N/N=C1\CCCc2oc(C(=O)NNC(=O)c3ccc(Br)cc3)c(C)c21 |
| InChI | InChI=1S/C23H21BrN4O5/c1-12-19-17(25-27-22(30)16-10-11-32-13(16)2)4-3-5-18(19)33-20(12)23(31)28-26-21(29)14-6-8-15(24)9-7-14/h6-11H,3-5H2,1-2H3,(H,26,29)(H,27,30)(H,28,31)/b25-17+ |
| InChIKey | JVBABZSHYBMONP-KOEQRZSOSA-N |
| XLogP | 3.80 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|