C30H23N3O5 — CID 19163215
[4-(4-cyanophenyl)phenyl] (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19163215) has the molecular formula C30H23N3O5 and a molecular weight of 505.53 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19163215 |
| Molecular Formula | C30H23N3O5 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)oc2c1/C(=N/NC(=O)c1ccccc1O)CCC2 |
| InChI | InChI=1S/C30H23N3O5/c1-18-27-24(32-33-29(35)23-5-2-3-7-25(23)34)6-4-8-26(27)38-28(18)30(36)37-22-15-13-21(14-16-22)20-11-9-19(17-31)10-12-20/h2-3,5,7,9-16,34H,4,6,8H2,1H3,(H,33,35)/b32-24+ |
| InChIKey | NFQQRDHSGLJACL-FEZSWGLMSA-N |
| XLogP | 5.52 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|