C17H17N3O2 — CID 164702540
N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-4-methoxybenzamide (PubChem CID 164702540) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-4-methoxybenzamide.
| Compound Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 164702540 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C2\CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C17H17N3O2/c1-22-14-9-7-13(8-10-14)17(21)20-19-15-6-2-4-12-5-3-11-18-16(12)15/h3,5,7-11H,2,4,6H2,1H3,(H,20,21)/b19-15+ |
| InChIKey | SQIMXGKPNIPSTI-XDJHFCHBSA-N |
| XLogP | 2.56 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|