C21H24N6OS — CID 163213850
N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-6-(4-methoxy-2-pyridinyl)-2,6-diazaspiro[3.3]heptane-2-carbothioamide (PubChem CID 163213850) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-6-(4-methoxy-2-pyridinyl)-2,6-diazaspiro[3.3]heptane-2-carbothioamide.
| Compound Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-6-(4-methoxy-2-pyridinyl)-2,6-diazaspiro[3.3]heptane-2-carbothioamide |
|---|---|
| PubChem CID | 163213850 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-6-(4-methoxy-2-pyridinyl)-2,6-diazaspiro[3.3]heptane-2-carbothioamide |
| SMILES | COc1ccnc(N2CC3(CN(C(=S)N/N=C4\CCCc5cccnc54)C3)C2)c1 |
| InChI | InChI=1S/C21H24N6OS/c1-28-16-7-9-22-18(10-16)26-11-21(12-26)13-27(14-21)20(29)25-24-17-6-2-4-15-5-3-8-23-19(15)17/h3,5,7-10H,2,4,6,11-14H2,1H3,(H,25,29)/b24-17+ |
| InChIKey | AWEWCUXVVQLPJO-JJIBRWJFSA-N |
| XLogP | 2.22 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|