C25H25N3O4S — CID 3893125
3-[(4-methoxyphenyl)sulfamoyl]-N-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino)benzamide (PubChem CID 3893125) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfamoyl]-N-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino)benzamide.
| Compound Name | 3-[(4-methoxyphenyl)sulfamoyl]-N-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino)benzamide |
|---|---|
| PubChem CID | 3893125 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfamoyl]-N-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino)benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NN=C3CCCCc4ccccc43)c2)cc1 |
| InChI | InChI=1S/C25H25N3O4S/c1-32-21-15-13-20(14-16-21)28-33(30,31)22-10-6-9-19(17-22)25(29)27-26-24-12-5-3-8-18-7-2-4-11-23(18)24/h2,4,6-7,9-11,13-17,28H,3,5,8,12H2,1H3,(H,27,29) |
| InChIKey | RVAYHIMDOUSEOI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|