C24H18N4O2 — CID 9216689
N-[(Z)-2,3-dihydrochromen-4-ylideneamino]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 9216689) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydrochromen-4-ylideneamino]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-2,3-dihydrochromen-4-ylideneamino]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 9216689 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[(Z)-2,3-dihydrochromen-4-ylideneamino]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C1/CCOc2ccccc21)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C24H18N4O2/c29-24(28-27-21-11-14-30-23-8-4-2-6-18(21)23)19-15-22(16-9-12-25-13-10-16)26-20-7-3-1-5-17(19)20/h1-10,12-13,15H,11,14H2,(H,28,29)/b27-21- |
| InChIKey | HNTCYJRWESOHQY-MEFGMAGPSA-N |
| XLogP | 4.21 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|