C24H18N4O — CID 3277531
N-(2,3-dihydroinden-1-ylideneamino)-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 3277531) has the molecular formula C24H18N4O and a molecular weight of 378.44 g/mol. Its IUPAC name is N-(2,3-dihydroinden-1-ylideneamino)-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-(2,3-dihydroinden-1-ylideneamino)-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3277531 |
| Molecular Formula | C24H18N4O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-(2,3-dihydroinden-1-ylideneamino)-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(NN=C1CCc2ccccc21)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C24H18N4O/c29-24(28-27-22-12-11-16-6-1-2-8-18(16)22)20-14-23(17-7-5-13-25-15-17)26-21-10-4-3-9-19(20)21/h1-10,13-15H,11-12H2,(H,28,29) |
| InChIKey | WBPTXUZMEDMPOY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|