C25H24N4O — CID 9078583
N-(2-adamantylideneamino)-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 9078583) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is N-(2-adamantylideneamino)-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-(2-adamantylideneamino)-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 9078583 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-(2-adamantylideneamino)-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(NN=C1C2CC3CC(C2)CC1C3)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C25H24N4O/c30-25(29-28-24-18-9-15-8-16(11-18)12-19(24)10-15)21-13-23(17-4-3-7-26-14-17)27-22-6-2-1-5-20(21)22/h1-7,13-16,18-19H,8-12H2,(H,29,30)/b28-24- |
| InChIKey | ZAWIFDCTXHHUCX-COOPMVRXSA-N |
| XLogP | 4.84 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|