C23H23N3O — CID 7933716
N-(cyclohexylideneamino)-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 7933716) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is N-(cyclohexylideneamino)-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-(cyclohexylideneamino)-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 7933716 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(cyclohexylideneamino)-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NN=C3CCCCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H23N3O/c1-16-11-13-17(14-12-16)22-15-20(19-9-5-6-10-21(19)24-22)23(27)26-25-18-7-3-2-4-8-18/h5-6,9-15H,2-4,7-8H2,1H3,(H,26,27) |
| InChIKey | KJPUYWSJCYLVDG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|