C26H30N4O — CID 40574020
2-[4-[(2R)-butan-2-yl]phenyl]-N-[(1-methylpiperidin-4-ylidene)amino]quinoline-4-carboxamide (PubChem CID 40574020) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[4-[(2R)-butan-2-yl]phenyl]-N-[(1-methylpiperidin-4-ylidene)amino]quinoline-4-carboxamide.
| Compound Name | 2-[4-[(2R)-butan-2-yl]phenyl]-N-[(1-methylpiperidin-4-ylidene)amino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 40574020 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-[4-[(2R)-butan-2-yl]phenyl]-N-[(1-methylpiperidin-4-ylidene)amino]quinoline-4-carboxamide |
| SMILES | CC[C@@H](C)c1ccc(-c2cc(C(=O)NN=C3CCN(C)CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H30N4O/c1-4-18(2)19-9-11-20(12-10-19)25-17-23(22-7-5-6-8-24(22)27-25)26(31)29-28-21-13-15-30(3)16-14-21/h5-12,17-18H,4,13-16H2,1-3H3,(H,29,31)/t18-/m1/s1 |
| InChIKey | FLKYLXGFZOTGEN-GOSISDBHSA-N |
| XLogP | 5.23 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|