C33H36N4O — CID 29057547
2-[4-[(2R)-butan-2-yl]phenyl]-N-[[1-(2-phenylethyl)piperidin-4-ylidene]amino]quinoline-4-carboxamide (PubChem CID 29057547) has the molecular formula C33H36N4O and a molecular weight of 504.68 g/mol. Its IUPAC name is 2-[4-[(2R)-butan-2-yl]phenyl]-N-[[1-(2-phenylethyl)piperidin-4-ylidene]amino]quinoline-4-carboxamide.
| Compound Name | 2-[4-[(2R)-butan-2-yl]phenyl]-N-[[1-(2-phenylethyl)piperidin-4-ylidene]amino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 29057547 |
| Molecular Formula | C33H36N4O |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 2-[4-[(2R)-butan-2-yl]phenyl]-N-[[1-(2-phenylethyl)piperidin-4-ylidene]amino]quinoline-4-carboxamide |
| SMILES | CC[C@@H](C)c1ccc(-c2cc(C(=O)NN=C3CCN(CCc4ccccc4)CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C33H36N4O/c1-3-24(2)26-13-15-27(16-14-26)32-23-30(29-11-7-8-12-31(29)34-32)33(38)36-35-28-18-21-37(22-19-28)20-17-25-9-5-4-6-10-25/h4-16,23-24H,3,17-22H2,1-2H3,(H,36,38)/t24-/m1/s1 |
| InChIKey | AVKYXAKOKFXOTA-XMMPIXPASA-N |
| XLogP | 6.84 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|