C20H33N5O2S+2 — CID 9216820
1-(2-morpholin-4-ium-4-ylethyl)-3-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]thiourea (PubChem CID 9216820) has the molecular formula C20H33N5O2S+2 and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-(2-morpholin-4-ium-4-ylethyl)-3-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]thiourea.
| Compound Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 9216820 |
| Molecular Formula | C20H33N5O2S+2 |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]thiourea |
| SMILES | C/C(=N/NC(=S)NCC[NH+]1CCOCC1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H31N5O2S/c1-17(22-23-20(28)21-7-8-24-9-13-26-14-10-24)19(18-5-3-2-4-6-18)25-11-15-27-16-12-25/h2-6,19H,7-16H2,1H3,(H2,21,23,28)/p+2/b22-17-/t19-/m1/s1 |
| InChIKey | UPOCPTMSWGNCAI-YQPBSLOJSA-P |
| XLogP | -1.60 |
| TPSA | 63.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|