C22H28N3O4+ — CID 9217593
2-(4-methoxyphenoxy)-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]acetamide (PubChem CID 9217593) has the molecular formula C22H28N3O4+ and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 9217593 |
| Molecular Formula | C22H28N3O4+ |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]acetamide |
| SMILES | COc1ccc(OCC(=O)N/N=C(/C)[C@H](c2ccccc2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-17(22(18-6-4-3-5-7-18)25-12-14-28-15-13-25)23-24-21(26)16-29-20-10-8-19(27-2)9-11-20/h3-11,22H,12-16H2,1-2H3,(H,24,26)/p+1/b23-17-/t22-/m1/s1 |
| InChIKey | MFAJDSMCQLOIEY-CJSSZYOBSA-O |
| XLogP | 1.22 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|