C17H23N4O2S+ — CID 7934238
1-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 7934238) has the molecular formula C17H23N4O2S+ and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7934238 |
| Molecular Formula | C17H23N4O2S+ |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | C/C(=N/NC(=S)NCC[NH+]1CCOCC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H22N4O2S/c1-13(16-12-14-4-2-3-5-15(14)23-16)19-20-17(24)18-6-7-21-8-10-22-11-9-21/h2-5,12H,6-11H2,1H3,(H2,18,20,24)/p+1/b19-13- |
| InChIKey | YBNDJYONNBFIKA-UYRXBGFRSA-O |
| XLogP | 0.54 |
| TPSA | 63.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|